CAS 195136-58-4 appears in our catalog under these names: 2',7'-Difluorofluorescein, >95% (HPLC), Oregon Green™ 488, 2',7'-Difluorofluorescein, >95.0%(HPLC)(qNMR), 2'',7''-Difluorofluorescein, 2',7'-Difluoro-3',6'-dihydroxy-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one, 98+%, 98+%. Offered by: TRC, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 100mg, 500mg, 50mg, 25mg, 250mg, 1g, 50 mg, 25 mg.
2',7'-difluoro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 195136-58-4) is a chemical compound with the molecular formula C20H10F2O5 and a molecular weight of 368.3 g/mol. IUPAC name: 2',7'-difluoro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: FJXJIUHGLVUXQP-UHFFFAOYSA-N.
| Molecular formula | C20H10F2O5 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | 2',7'-difluoro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | FJXJIUHGLVUXQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C=C4OC5=CC(=C(C=C35)F)O)O)F |
Computed by PubChem (NCBI)