2-(2-((2,6-Dichlorophenyl)amino)phenyl)acetic acid, 99%, 99%
cas: 15307-86-5 — see every product listed under this CAS number, including other names
2-(2-((2,6-Dichlorophenyl)amino)phenyl)acetic acid, 99%, 99% (CAS 15307-86-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149A1-5g |
| cas | 15307-86-5 |
| size | 5g |
| availability | 25000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 102.80 Pln | |
| Chemat | 100g | 131.60 Pln | |
| Chemat | 250g | 218.00 Pln | |
| Chemat | 500g | 403.20 Pln | |
| Chemat | 1kg | 650.00 Pln | |
| Chemat | 5kg | 2496.00 Pln | |
| Chemat | 10kg | price on request |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Diclofenac is a monocarboxylic acid consisting of phenylacetic acid having a (2,6-dichlorophenyl)amino group at the 2-position. It has a role as a non-steroidal anti-inflammatory drug, a non-narcotic analgesic, an antipyretic, an EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor, a xenobiotic, an environmental contaminant and a drug allergen. It is a dichlorobenzene, a monocarboxylic acid, an amino acid, an aromatic amine and a secondary amino compound. It is functionally related to a phenylacetic acid and a diphenylamine. It is a conjugate acid of a diclofenac(1-).
Source: ChEBI
| Molecular formula | C14H11Cl2NO2 |
|---|---|
| Molecular weight | 296.1 g/mol |
| IUPAC name | 2-[2-(2,6-dichloroanilino)phenyl]acetic acid |
| InChIKey | DCOPUUMXTXDBNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)