CAS 92103-43-0 is the registry number for 2-((E)-[(2,5-Dichlorophenyl)imino]methyl)-6-methoxyphenol, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-[(2,5-dichlorophenyl)iminomethyl]-6-methoxyphenol (CAS 92103-43-0) is a chemical compound with the molecular formula C14H11Cl2NO2 and a molecular weight of 296.1 g/mol. IUPAC name: 2-[(2,5-dichlorophenyl)iminomethyl]-6-methoxyphenol. InChIKey: MMMJXYJXDIMUAU-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO2 |
|---|---|
| Molecular weight | 296.1 g/mol |
| IUPAC name | 2-[(2,5-dichlorophenyl)iminomethyl]-6-methoxyphenol |
| InChIKey | MMMJXYJXDIMUAU-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1O)C=NC2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)