2-(2-((tert-Butoxycarbonyl)amino)ethoxy)ethyl 4-methylbenzenesulfonate, 98%, 98%
cas: 192132-77-7 — see every product listed under this CAS number, including other names
2-(2-((tert-Butoxycarbonyl)amino)ethoxy)ethyl 4-methylbenzenesulfonate, 98%, 98% (CAS 192132-77-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JWPB-250mg |
| cas | 192132-77-7 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 500mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 270.80 Pln | |
| Chemat | 25g | 491.60 Pln | |
| Chemat | 50g | 846.80 Pln | |
| Chemat | 100g | 1485.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 192132-77-7) is a chemical compound with the molecular formula C16H25NO6S and a molecular weight of 359.4 g/mol. IUPAC name: 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: JVGNPGXHRHJTFJ-UHFFFAOYSA-N.
| Molecular formula | C16H25NO6S |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | JVGNPGXHRHJTFJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Tos-PEG2-NH-Boc, 2-(2-((tert-butoxycarbonyl)amino)ethoxy)ethyl 4-methylbenzenesulfonate, 2-(2-((tert-Butoxycarbonyl)amino)ethoxy)-ethyl 4-methylbenzenesulfonate, 2-[2-(tert-butoxycarbonylamino)ethoxy]ethyl 4-methylbenzenesulfonate, 2-(2-((tert-butoxycarbonyl)amino)ethoxy)ethyl4-methylbenzenesulfonate, 2-(2-(tert-butoxycarbonylamino)ethoxy)ethyl 4-methylbenzenesulfonate, 2-{2-[(tert-butoxycarbonyl)amino]ethoxy}ethyl 4-methylbenzenesulfonate, starbld0009772, Boc-NH-PEG1-Tosylate, orb1909203