CAS 192132-77-7 appears in our catalog under these names: 2-(2-((tert-Butoxycarbonyl)amino)ethoxy)-ethyl 4-methylbenzenesulfonate, 95%, Tos–PEG2–NH–Boc, Tos-PEG2-NH-Boc 98%, 2-(2-((tert-Butoxycarbonyl)amino)ethoxy)ethyl 4-methylbenzenesulfonate, 98%, 98%, 2-(2-((tert-butoxycarbonyl)amino)ethoxy)ethyl4-methylbenzenesulfonate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10mM (in 1ml dmso), 50mg, 25g, 500mg.
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 192132-77-7) is a chemical compound with the molecular formula C16H25NO6S and a molecular weight of 359.4 g/mol. IUPAC name: 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: JVGNPGXHRHJTFJ-UHFFFAOYSA-N.
| Molecular formula | C16H25NO6S |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | JVGNPGXHRHJTFJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)