cas: 1263045-93-7 — see every product listed under this CAS number, including other names
2-(2-(2-((1-(4,4-Dimethyl-2,6-dioxocyclohexylidene)ethyl)amino)ethoxy)ethoxy)acetic acid 95% (CAS 1263045-93-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A986686-100mg |
| cas | 1263045-93-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1032.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A986686 |
2-[2-[2-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]ethoxy]ethoxy]acetic acid (CAS 1263045-93-7) is a chemical compound with the molecular formula C16H25NO6 and a molecular weight of 327.37 g/mol. IUPAC name: 2-[2-[2-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]ethoxy]ethoxy]acetic acid. InChIKey: IHICFPPUJJDEHO-UHFFFAOYSA-N.
| Molecular formula | C16H25NO6 |
|---|---|
| Molecular weight | 327.37 g/mol |
| IUPAC name | 2-[2-[2-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]ethoxy]ethoxy]acetic acid |
| InChIKey | IHICFPPUJJDEHO-UHFFFAOYSA-N |
| SMILES | CC(=NCCOCCOCC(=O)O)C1=C(CC(CC1=O)(C)C)O |
Computed by PubChem (NCBI)