cas: 380430-66-0 — see every product listed under this CAS number, including other names
2-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)isoindoline-1,3-dione 98% (CAS 380430-66-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A535687-250mg |
| cas | 380430-66-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 776.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A535687 |
2-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]isoindole-1,3-dione (CAS 380430-66-0) is a chemical compound with the molecular formula C21H22BNO4 and a molecular weight of 363.2 g/mol. IUPAC name: 2-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]isoindole-1,3-dione. InChIKey: HXXPHCDZEYKJQR-UHFFFAOYSA-N.
| Molecular formula | C21H22BNO4 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | 2-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]isoindole-1,3-dione |
| InChIKey | HXXPHCDZEYKJQR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CN3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)