cas: 380430-66-0 — see every product listed under this CAS number, including other names
2-Phthalimidomethylphenylboronic acid, pinacol ester, 98%, 98% (CAS 380430-66-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C1XR-100mg |
| cas | 380430-66-0 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 194.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]isoindole-1,3-dione (CAS 380430-66-0) is a chemical compound with the molecular formula C21H22BNO4 and a molecular weight of 363.2 g/mol. IUPAC name: 2-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]isoindole-1,3-dione. InChIKey: HXXPHCDZEYKJQR-UHFFFAOYSA-N.
| Molecular formula | C21H22BNO4 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | 2-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]isoindole-1,3-dione |
| InChIKey | HXXPHCDZEYKJQR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CN3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)