cas: 931374-29-7 — see every product listed under this CAS number, including other names
2-(2-(4-Pentanamidobenzamido)thiazol-4-yl)acetic acid, 97% (CAS 931374-29-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A717592-5g |
| cas | 931374-29-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 2361.52 Pln | |
| AmBeed | 1g | 838.18 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[2-[[4-(pentanoylamino)benzoyl]amino]-1,3-thiazol-4-yl]acetic acid (CAS 931374-29-7) is a chemical compound with the molecular formula C17H19N3O4S and a molecular weight of 361.4 g/mol. IUPAC name: 2-[2-[[4-(pentanoylamino)benzoyl]amino]-1,3-thiazol-4-yl]acetic acid. InChIKey: YYEDCQXLUBNFQI-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O4S |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 2-[2-[[4-(pentanoylamino)benzoyl]amino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | YYEDCQXLUBNFQI-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)NC1=CC=C(C=C1)C(=O)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)