Products 1189891-71-1
CAS 1189891-71-1 appears in our catalog under these names: Omeprazole metabolite Omeprazole sulfone (methoxy–d3), Omeprazole-d3 Sulfone, >95% (HPLC), Omeprazole metabolite Omeprazole sulfone (methoxy-d3), 99.0%. Offered by: GLPBio, TRC, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg.
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-(trideuteriomethoxy)-1H-benzimidazole (CAS 1189891-71-1) is a chemical compound with the molecular formula C17H19N3O4S and a molecular weight of 364.4 g/mol. IUPAC name: 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-(trideuteriomethoxy)-1H-benzimidazole. InChIKey: IXEQEYRTSRFZEO-HPRDVNIFSA-N.
| Molecular formula | C17H19N3O4S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfonyl]-6-(trideuteriomethoxy)-1H-benzimidazole |
| InChIKey | IXEQEYRTSRFZEO-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)N=C(N2)S(=O)(=O)CC3=NC=C(C(=C3C)OC)C |
Computed by PubChem (NCBI)