2-(2-(Bromomethyl)-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%
cas: 2096332-57-7 — see every product listed under this CAS number, including other names
2-(2-(Bromomethyl)-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 2096332-57-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1522341-250mg |
| cas | 2096332-57-7 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 25g | 4469.94 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1522341 |
2-[2-(bromomethyl)-3-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2096332-57-7) is a chemical compound with the molecular formula C13H17BBrFO2 and a molecular weight of 314.99 g/mol. IUPAC name: 2-[2-(bromomethyl)-3-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CWIYMJFSXNPNHT-UHFFFAOYSA-N.
| Molecular formula | C13H17BBrFO2 |
|---|---|
| Molecular weight | 314.99 g/mol |
| IUPAC name | 2-[2-(bromomethyl)-3-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CWIYMJFSXNPNHT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)F)CBr |
Computed by PubChem (NCBI)
Synonyms:
2-Bromomethyl-3-chlorophenylboronic acid, pinacol ester, 2-(2-(Bromomethyl)-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-Bromomethyl-3-fluorophenylboronic acid pinacol ester, 2-Bromomethyl-3-fluorophenylboronic acid, pinacol ester, 1,3,2-Dioxaborolane, 2-[2-(bromomethyl)-3-fluorophenyl]-4,4,5,5-tetramethyl-, 2-[2-(bromomethyl)-3-fluoro-phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane