Products 2121512-72-7
CAS 2121512-72-7 appears in our catalog under these names: 2-Bromo-6-fluoro-3-methylphenylboronic acid pinacol ester, 95%, 2-(2-Bromo-6-fluoro-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2-(2-bromo-6-fluoro-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-72-7) is a chemical compound with the molecular formula C13H17BBrFO2 and a molecular weight of 314.99 g/mol. IUPAC name: 2-(2-bromo-6-fluoro-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GZBCTMFOBKRHHZ-UHFFFAOYSA-N.
| Molecular formula | C13H17BBrFO2 |
|---|---|
| Molecular weight | 314.99 g/mol |
| IUPAC name | 2-(2-bromo-6-fluoro-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GZBCTMFOBKRHHZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2Br)C)F |
Computed by PubChem (NCBI)