cas: 957034-64-9 — see every product listed under this CAS number, including other names
2-(2-(Bromomethyl)-4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 957034-64-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EQ3-100mg |
| cas | 957034-64-9 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2334.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-(bromomethyl)-4-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 957034-64-9) is a chemical compound with the molecular formula C13H17BBrClO2 and a molecular weight of 331.44 g/mol. IUPAC name: 2-[2-(bromomethyl)-4-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SKRIXHSLRIIJGJ-UHFFFAOYSA-N.
| Molecular formula | C13H17BBrClO2 |
|---|---|
| Molecular weight | 331.44 g/mol |
| IUPAC name | 2-[2-(bromomethyl)-4-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SKRIXHSLRIIJGJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)CBr |
Computed by PubChem (NCBI)