CAS 2096335-91-8 appears in our catalog under these names: 2-(Bromomethyl)-3-chlorophenylboronic acid, pinacol ester, 97%, 2-(2-(Bromomethyl)-3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2-(Bromomethyl)-3-chlorophenylboronic acid, pinacol ester, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g.
2-[2-(bromomethyl)-3-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2096335-91-8) is a chemical compound with the molecular formula C13H17BBrClO2 and a molecular weight of 331.44 g/mol. IUPAC name: 2-[2-(bromomethyl)-3-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HHFMETIHUMNDBF-UHFFFAOYSA-N.
| Molecular formula | C13H17BBrClO2 |
|---|---|
| Molecular weight | 331.44 g/mol |
| IUPAC name | 2-[2-(bromomethyl)-3-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HHFMETIHUMNDBF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Cl)CBr |
Computed by PubChem (NCBI)