cas: 2604514-82-9 — see every product listed under this CAS number, including other names
2-(2-(Difluoromethyl)-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 2604514-82-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1737878-5g |
| cas | 2604514-82-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 18265.45 Pln | |
| AmBeed | 10g | 26474.56 Pln | |
| Fluorochem | 100mg | 1273.53 Pln | |
| Fluorochem | 250mg | 2085.74 Pln | |
| Fluorochem | 500mg | 3132.25 Pln | |
| Fluorochem | 1g | 4074.62 Pln | |
| Fluorochem | 2.5g | 7557.77 Pln | |
| Fluorochem | 5g | 11504.30 Pln | |
| Fluorochem | 10g | 16663.94 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[2-(difluoromethyl)-4,5-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2604514-82-9) is a chemical compound with the molecular formula C13H15BF4O2 and a molecular weight of 290.06 g/mol. IUPAC name: 2-[2-(difluoromethyl)-4,5-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CZXLCXXCJYVGCW-UHFFFAOYSA-N.
| Molecular formula | C13H15BF4O2 |
|---|---|
| Molecular weight | 290.06 g/mol |
| IUPAC name | 2-[2-(difluoromethyl)-4,5-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CZXLCXXCJYVGCW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2C(F)F)F)F |
Computed by PubChem (NCBI)