CAS 1192045-31-0 appears in our catalog under these names: 2-Fluoro-5-(trifluoromethyl)benzeneboronic Acid Pinacol Ester, 2-Fluoro-5-(trifluoromethyl)benzeneboronic Acid Pinacol Ester, 97%, 97%, 2-Fluoro-5-(trifluoromethyl)phenylboronic acid pinacol ester, 97%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
2-[2-fluoro-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1192045-31-0) is a chemical compound with the molecular formula C13H15BF4O2 and a molecular weight of 290.06 g/mol. IUPAC name: 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HTWDNOHKJZHVNK-UHFFFAOYSA-N.
| Molecular formula | C13H15BF4O2 |
|---|---|
| Molecular weight | 290.06 g/mol |
| IUPAC name | 2-[2-fluoro-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HTWDNOHKJZHVNK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(F)(F)F)F |
Computed by PubChem (NCBI)