cas: 173336-67-9 — see every product listed under this CAS number, including other names
2-(2-(Morpholinosulfonyl)ethyl)isoindoline-1,3-dione, 97% (CAS 173336-67-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1231888-5g |
| cas | 173336-67-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6150.34 Pln | |
| AmBeed | 250mg | 402.01 Pln | |
| AmBeed | 100mg | 206.71 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2-morpholin-4-ylsulfonylethyl)isoindole-1,3-dione (CAS 173336-67-9) is a chemical compound with the molecular formula C14H16N2O5S and a molecular weight of 324.35 g/mol. IUPAC name: 2-(2-morpholin-4-ylsulfonylethyl)isoindole-1,3-dione. InChIKey: IVEIQOGSYKUHEE-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O5S |
|---|---|
| Molecular weight | 324.35 g/mol |
| IUPAC name | 2-(2-morpholin-4-ylsulfonylethyl)isoindole-1,3-dione |
| InChIKey | IVEIQOGSYKUHEE-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)CCN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)