cas: 173336-67-9 — see every product listed under this CAS number, including other names
2-[2-(Morpholine-4-sulfonyl)ethyl]-2,3-dihydro-1H-isoindole-1,3-dione, 97% (CAS 173336-67-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603839-100MG |
| cas | 173336-67-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 581.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-morpholin-4-ylsulfonylethyl)isoindole-1,3-dione (CAS 173336-67-9) is a chemical compound with the molecular formula C14H16N2O5S and a molecular weight of 324.35 g/mol. IUPAC name: 2-(2-morpholin-4-ylsulfonylethyl)isoindole-1,3-dione. InChIKey: IVEIQOGSYKUHEE-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O5S |
|---|---|
| Molecular weight | 324.35 g/mol |
| IUPAC name | 2-(2-morpholin-4-ylsulfonylethyl)isoindole-1,3-dione |
| InChIKey | IVEIQOGSYKUHEE-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)CCN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)