cas: 2121513-56-0 — see every product listed under this CAS number, including other names
2-(2-Bromo-3-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95% (CAS 2121513-56-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A647001-250mg |
| cas | 2121513-56-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1944.56 Pln | |
| Ambeed | 50mg | 681.88 Pln | |
| Ambeed | 100mg | 1110.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A647001 |
2-[2-bromo-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121513-56-0) is a chemical compound with the molecular formula C13H15BBrF3O2 and a molecular weight of 350.97 g/mol. IUPAC name: 2-[2-bromo-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IDUZBJPSTPAOJJ-UHFFFAOYSA-N.
| Molecular formula | C13H15BBrF3O2 |
|---|---|
| Molecular weight | 350.97 g/mol |
| IUPAC name | 2-[2-bromo-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IDUZBJPSTPAOJJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)