cas: 1187647-98-8 — see every product listed under this CAS number, including other names
2-(2-Bromo-5-chlorophenyl)-1,3-dioxolane (CAS 1187647-98-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631034-5G |
| cas | 1187647-98-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1856.66 Pln | |
| Fluorochem | 10g | 3106.22 Pln |
| delivery time | 3-4 weeks |
|---|
2-(2-bromo-5-chlorophenyl)-1,3-dioxolane (CAS 1187647-98-8) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: 2-(2-bromo-5-chlorophenyl)-1,3-dioxolane. InChIKey: NNDNLSLPRKSWRC-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | 2-(2-bromo-5-chlorophenyl)-1,3-dioxolane |
| InChIKey | NNDNLSLPRKSWRC-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CC(=C2)Cl)Br |
Computed by PubChem (NCBI)