Products 124573-93-9
CAS 124573-93-9 appears in our catalog under these names: Methyl 2-(4-bromophenyl)-2-chloroacetate, 95%, Methyl 2-(4-bromophenyl)-2-chloroacetate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 50mg, 0,5g.
Methyl 2-(4-bromophenyl)-2-chloroacetate (CAS 124573-93-9) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: methyl 2-(4-bromophenyl)-2-chloroacetate. InChIKey: NSGPRRIZASKEEN-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | methyl 2-(4-bromophenyl)-2-chloroacetate |
| InChIKey | NSGPRRIZASKEEN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)