cas: 1256781-58-4 — see every product listed under this CAS number, including other names
2-(2-Bromo-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95+% (CAS 1256781-58-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F696245-250MG |
| cas | 1256781-58-4 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 737.26 Pln | |
| Fluorochem | 5g | 2351.27 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1393.88 Pln | |
| Ambeed | 25g | 5465.62 Pln | |
| Ambeed | 100g | 17107.94 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 515.60 Pln | |
| Chemat | 5g | 1629.20 Pln | |
| Chemat | 25g | 5546.00 Pln |
| purity | 95+% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-(2-bromo-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1256781-58-4) is a chemical compound with the molecular formula C13H18BBrO3 and a molecular weight of 313.00 g/mol. IUPAC name: 2-(2-bromo-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RHHZDWKRQWEDAL-UHFFFAOYSA-N.
| Molecular formula | C13H18BBrO3 |
|---|---|
| Molecular weight | 313.00 g/mol |
| IUPAC name | 2-(2-bromo-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RHHZDWKRQWEDAL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)OC)Br |
Computed by PubChem (NCBI)