Products 2180971-01-9
CAS 2180971-01-9 appears in our catalog under these names: 2-(4-Bromo-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(4-Bromo-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-(4-bromo-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2180971-01-9) is a chemical compound with the molecular formula C13H18BBrO3 and a molecular weight of 313.00 g/mol. IUPAC name: 2-(4-bromo-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SGPKTZKGWOXRFR-UHFFFAOYSA-N.
| Molecular formula | C13H18BBrO3 |
|---|---|
| Molecular weight | 313.00 g/mol |
| IUPAC name | 2-(4-bromo-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SGPKTZKGWOXRFR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Br)OC |
Computed by PubChem (NCBI)