2-(2-Bromo-6-chlorophenyl)propanoic acid, 95%
cas: 1785122-31-7 — see every product listed under this CAS number, including other names
2-(2-Bromo-6-chlorophenyl)propanoic acid, 95% (CAS 1785122-31-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1021606-250mg |
| cas | 1785122-31-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1288.19 Pln | |
| Ambeed | 1g | 3351.88 Pln | |
| Chemat | 100mg | 726.80 Pln | |
| Chemat | 250mg | 1187.60 Pln | |
| Chemat | 1g | 3098.00 Pln | |
| BLDpharm | 100mg | 769.75 Pln | |
| BLDpharm | 250mg | 1269.58 Pln | |
| BLDpharm | 1g | 3285.53 Pln | |
| BLDpharm | 5g | 12943.24 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-bromo-6-chlorophenyl)propanoic acid (CAS 1785122-31-7) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: 2-(2-bromo-6-chlorophenyl)propanoic acid. InChIKey: PXKZWFFXPGFGJY-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | 2-(2-bromo-6-chlorophenyl)propanoic acid |
| InChIKey | PXKZWFFXPGFGJY-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC=C1Br)Cl)C(=O)O |
Computed by PubChem (NCBI)