cas: 446852-65-9 — see every product listed under this CAS number, including other names
2-(2-Bromopyridin-4-yl)-1-(pyridin-2-yl)ethanone, 98% (CAS 446852-65-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F600307-100MG |
| cas | 446852-65-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 716.43 Pln | |
| Fluorochem | 250mg | 1372.45 Pln | |
| Fluorochem | 1g | 2955.23 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-bromo-4-pyridinyl)-1-pyridin-2-ylethanone (CAS 446852-65-9) is a chemical compound with the molecular formula C12H9BrN2O and a molecular weight of 277.12 g/mol. IUPAC name: 2-(2-bromo-4-pyridinyl)-1-pyridin-2-ylethanone. InChIKey: RKVGSLYSLROWJI-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O |
|---|---|
| Molecular weight | 277.12 g/mol |
| IUPAC name | 2-(2-bromo-4-pyridinyl)-1-pyridin-2-ylethanone |
| InChIKey | RKVGSLYSLROWJI-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)CC2=CC(=NC=C2)Br |
Computed by PubChem (NCBI)