CAS 855360-86-0 appears in our catalog under these names: 5-Bromo-1,10-phenanthroline monohydrate, 95%, 5–Bromo–1,10–phenanthroline hydrate, 5-Bromo-1,10-phenanthroline hydrate 95%, 5-Bromo-1,10-phenanthroline Monohydrate, 95%, 95%, 5-Bromo-1,10-phenanthroline hydrate, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg.
5-bromo-1,10-phenanthroline;hydrate (CAS 855360-86-0) is a chemical compound with the molecular formula C12H9BrN2O and a molecular weight of 277.12 g/mol. IUPAC name: 5-bromo-1,10-phenanthroline;hydrate. InChIKey: VTTKUSYSKOIISY-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O |
|---|---|
| Molecular weight | 277.12 g/mol |
| IUPAC name | 5-bromo-1,10-phenanthroline;hydrate |
| InChIKey | VTTKUSYSKOIISY-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)Br.O |
Computed by PubChem (NCBI)