2-(2-Chlorophenoxy)aniline, 95%
cas: 56966-47-3 — see every product listed under this CAS number, including other names
2-(2-Chlorophenoxy)aniline, 95% (CAS 56966-47-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A130425-250mg |
| cas | 56966-47-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1571.88 Pln | |
| Ambeed | 5g | 4442.12 Pln | |
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 2238.80 Pln | |
| BLDpharm | 100mg | 508.73 Pln | |
| BLDpharm | 250mg | 692.00 Pln | |
| BLDpharm | 1g | 1691.65 Pln | |
| BLDpharm | 5g | 4785.01 Pln | |
| Fluorochem | 1g | 4142.31 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-chlorophenoxy)aniline (CAS 56966-47-3) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 2-(2-chlorophenoxy)aniline. InChIKey: KSDCPEXSRBLIRA-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 2-(2-chlorophenoxy)aniline |
| InChIKey | KSDCPEXSRBLIRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)