cas: 167692-95-7 — see every product listed under this CAS number, including other names
2-(2-Cyclohexylethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 167692-95-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1249044-100mg |
| cas | 167692-95-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 670.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1249044 |
2-(2-cyclohexylethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 167692-95-7) is a chemical compound with the molecular formula C14H27BO2 and a molecular weight of 238.18 g/mol. IUPAC name: 2-(2-cyclohexylethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LDKDGYZAIIKCGK-UHFFFAOYSA-N.
| Molecular formula | C14H27BO2 |
|---|---|
| Molecular weight | 238.18 g/mol |
| IUPAC name | 2-(2-cyclohexylethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LDKDGYZAIIKCGK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC2CCCCC2 |
Computed by PubChem (NCBI)