cas: 167692-95-7 — see every product listed under this CAS number, including other names
2-(2-Cyclohexylethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 167692-95-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AMMV-100mg |
| cas | 167692-95-7 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 693.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-cyclohexylethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 167692-95-7) is a chemical compound with the molecular formula C14H27BO2 and a molecular weight of 238.18 g/mol. IUPAC name: 2-(2-cyclohexylethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LDKDGYZAIIKCGK-UHFFFAOYSA-N.
| Molecular formula | C14H27BO2 |
|---|---|
| Molecular weight | 238.18 g/mol |
| IUPAC name | 2-(2-cyclohexylethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LDKDGYZAIIKCGK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC2CCCCC2 |
Computed by PubChem (NCBI)