2-(2-Fluoro-4-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%
cas: 1073353-68-0 — see every product listed under this CAS number, including other names
2-(2-Fluoro-4-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97% (CAS 1073353-68-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119SIP-250mg |
| cas | 1073353-68-0 |
| size | 250mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 419.60 Pln | |
| Chemat | 100mg | 83.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[2-fluoro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073353-68-0) is a chemical compound with the molecular formula C13H15BF4O2 and a molecular weight of 290.06 g/mol. IUPAC name: 2-[2-fluoro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZXEYGQNXUCXTBK-UHFFFAOYSA-N.
| Molecular formula | C13H15BF4O2 |
|---|---|
| Molecular weight | 290.06 g/mol |
| IUPAC name | 2-[2-fluoro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZXEYGQNXUCXTBK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(F)(F)F)F |
Computed by PubChem (NCBI)
Synonyms:
2-(2-Fluoro-4-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-Fluoro-4-trifluoromethylphenylboronic acid pinacol ester, 2-[2-fluoro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-Fluoro-4-trifluoromethylphenylboroni, 2-Fluoro-4-(trifluoromethy)lphenylboronic acid pinacol ester, 2-Fluoro-4-(trifluoromethyl)phenylboronic Acid Pinacol Ester, 2-Fluoro-4-trifluoromethylbenzeneboronic acid pinacol ester, 97%, 2-Fluoro-4-trifluoromethylphenylboronic acid pinacol ester, AldrichCPR, 2-(2-Fluoro-4-trifluoromethyl-phenyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane