cas: 517920-60-4 — see every product listed under this CAS number, including other names
2-(2-Fluorobenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 517920-60-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 50mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222604-1G |
| cas | 517920-60-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 1950.37 Pln | |
| Fluorochem | 50mg | 159.34 Pln | |
| Fluorochem | 250mg | 299.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[(2-fluorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 517920-60-4) is a chemical compound with the molecular formula C13H18BFO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-[(2-fluorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ABOCFFXSSUAFRP-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-[(2-fluorophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ABOCFFXSSUAFRP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=CC=C2F |
Computed by PubChem (NCBI)