CAS 391906-76-6 is the registry number for [2-(2-Fluorophenoxy)phenyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(2-fluorophenoxy)aniline (CAS 391906-76-6) is a chemical compound with the molecular formula C12H10FNO and a molecular weight of 203.21 g/mol. IUPAC name: 2-(2-fluorophenoxy)aniline. InChIKey: FMHXQFVNBSTBQV-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO |
|---|---|
| Molecular weight | 203.21 g/mol |
| IUPAC name | 2-(2-fluorophenoxy)aniline |
| InChIKey | FMHXQFVNBSTBQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OC2=CC=CC=C2F |
Computed by PubChem (NCBI)