CAS 41734-98-9 is the registry number for 6-Fluoro-2,3,4,9-tetrahydro-1h-carbazol-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-fluoro-2,3,4,9-tetrahydrocarbazol-1-one (CAS 41734-98-9) is a chemical compound with the molecular formula C12H10FNO and a molecular weight of 203.21 g/mol. IUPAC name: 6-fluoro-2,3,4,9-tetrahydrocarbazol-1-one. InChIKey: KXRCTKTUQDTGQN-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO |
|---|---|
| Molecular weight | 203.21 g/mol |
| IUPAC name | 6-fluoro-2,3,4,9-tetrahydrocarbazol-1-one |
| InChIKey | KXRCTKTUQDTGQN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)NC3=C2C=C(C=C3)F |
Computed by PubChem (NCBI)