cas: 468064-83-7 — see every product listed under this CAS number, including other names
2-(2-Methoxyphenyl)-2-methylpropanoic acid, 98%, 98% (CAS 468064-83-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E7MQ-100mg |
| cas | 468064-83-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 5g | 2320.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-methoxyphenyl)-2-methylpropanoic acid (CAS 468064-83-7) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 2-(2-methoxyphenyl)-2-methylpropanoic acid. InChIKey: IZBKHGFHJGMWGV-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-(2-methoxyphenyl)-2-methylpropanoic acid |
| InChIKey | IZBKHGFHJGMWGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1OC)C(=O)O |
Computed by PubChem (NCBI)