Products 468064-83-7
CAS 468064-83-7 appears in our catalog under these names: 2-(2-Methoxyphenyl)-2-methylpropanoic acid, 95%, 2–(2–methoxyphenyl)–2–methylpropanoic acid, 2-(2-Methoxyphenyl)-2-methylpropanoic acid, 2-(2-Methoxyphenyl)-2-methylpropanoic acid, 98%, 98%, 2-(2-Methoxyphenyl)-2-methylpropanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg, 0,5g, 5g.
2-(2-methoxyphenyl)-2-methylpropanoic acid (CAS 468064-83-7) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 2-(2-methoxyphenyl)-2-methylpropanoic acid. InChIKey: IZBKHGFHJGMWGV-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-(2-methoxyphenyl)-2-methylpropanoic acid |
| InChIKey | IZBKHGFHJGMWGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1OC)C(=O)O |
Computed by PubChem (NCBI)