cas: 46496-80-4 — see every product listed under this CAS number, including other names
2-(2-Thienylcarbonyl)benzoic acid, 98%, 98% (CAS 46496-80-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DFZP-100mg |
| cas | 46496-80-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 500mg | 203.60 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 597.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(thiophene-2-carbonyl)benzoic acid (CAS 46496-80-4) is a chemical compound with the molecular formula C12H8O3S and a molecular weight of 232.26 g/mol. IUPAC name: 2-(thiophene-2-carbonyl)benzoic acid. InChIKey: KPJANWLDEVDGEA-UHFFFAOYSA-N.
| Molecular formula | C12H8O3S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 2-(thiophene-2-carbonyl)benzoic acid |
| InChIKey | KPJANWLDEVDGEA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)