CAS 46496-80-4 appears in our catalog under these names: 2-(Thiophene-2-carbonyl)benzoic acid, 95%, 2-(2-Thienylcarbonyl)benzoic acid, 98%, 98%, 2-(2-Thenoyl)benzoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg, 2.5g.
2-(thiophene-2-carbonyl)benzoic acid (CAS 46496-80-4) is a chemical compound with the molecular formula C12H8O3S and a molecular weight of 232.26 g/mol. IUPAC name: 2-(thiophene-2-carbonyl)benzoic acid. InChIKey: KPJANWLDEVDGEA-UHFFFAOYSA-N.
| Molecular formula | C12H8O3S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 2-(thiophene-2-carbonyl)benzoic acid |
| InChIKey | KPJANWLDEVDGEA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)