cas: 669713-73-9 — see every product listed under this CAS number, including other names
2-(3'-Methoxy-[1,1'-biphenyl]-4-yl)acetic acid, 98%, 98% (CAS 669713-73-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAXE-100mg |
| cas | 669713-73-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 1096.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[4-(3-methoxyphenyl)phenyl]acetic acid (CAS 669713-73-9) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-[4-(3-methoxyphenyl)phenyl]acetic acid. InChIKey: RWCAHCLLXAXLGN-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-[4-(3-methoxyphenyl)phenyl]acetic acid |
| InChIKey | RWCAHCLLXAXLGN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)