Products 73252-09-2
CAS 73252-09-2 is the registry number for (3As,4r,5r,7s,7ar)-5-phenylhexahydro-4,7-methano-2-benzofuran-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-phenyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione (CAS 73252-09-2) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 8-phenyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione. InChIKey: QVZKCYULUXLGPJ-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 8-phenyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| InChIKey | QVZKCYULUXLGPJ-UHFFFAOYSA-N |
| SMILES | C1C2CC(C1C3C2C(=O)OC3=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)