cas: 165904-27-8 — see every product listed under this CAS number, including other names
2-(3,3-Diethoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 165904-27-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112WFF-100mg |
| cas | 165904-27-8 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 1298.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3,3-diethoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 165904-27-8) is a chemical compound with the molecular formula C13H27BO4 and a molecular weight of 258.16 g/mol. IUPAC name: 2-(3,3-diethoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VEDSPUPKZZMMLL-UHFFFAOYSA-N.
| Molecular formula | C13H27BO4 |
|---|---|
| Molecular weight | 258.16 g/mol |
| IUPAC name | 2-(3,3-diethoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VEDSPUPKZZMMLL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC(OCC)OCC |
Computed by PubChem (NCBI)