CAS 165904-27-8 appears in our catalog under these names: 3,3-Diethoxy-1-propylboronic acid pinacol ester, 95%, 2-(3,3-Diethoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 3,3-Diethoxy-1-propylboronic acid pinacol ester, 97% , 2-(3,3-Diethoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
2-(3,3-diethoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 165904-27-8) is a chemical compound with the molecular formula C13H27BO4 and a molecular weight of 258.16 g/mol. IUPAC name: 2-(3,3-diethoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VEDSPUPKZZMMLL-UHFFFAOYSA-N.
| Molecular formula | C13H27BO4 |
|---|---|
| Molecular weight | 258.16 g/mol |
| IUPAC name | 2-(3,3-diethoxypropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VEDSPUPKZZMMLL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC(OCC)OCC |
Computed by PubChem (NCBI)