cas: 1075719-78-6 — see every product listed under this CAS number, including other names
2-(3,4-Dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%, 96% (CAS 1075719-78-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1195LH-250mg |
| cas | 1075719-78-6 |
| size | 250mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 100mg | 203.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(3,4-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1075719-78-6) is a chemical compound with the molecular formula C12H15BBr2O2 and a molecular weight of 361.87 g/mol. IUPAC name: 2-(3,4-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SVTLSECRLPPTTC-UHFFFAOYSA-N.
| Molecular formula | C12H15BBr2O2 |
|---|---|
| Molecular weight | 361.87 g/mol |
| IUPAC name | 2-(3,4-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SVTLSECRLPPTTC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Br)Br |
Computed by PubChem (NCBI)