cas: 2657617-91-7 — see every product listed under this CAS number, including other names
2-(3,4-Difluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95% (CAS 2657617-91-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A742343-100mg |
| cas | 2657617-91-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 1905.62 Pln | |
| Ambeed | 5g | 6355.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A742343 |
2-(3,4-difluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2657617-91-7) is a chemical compound with the molecular formula C12H14BF2NO4 and a molecular weight of 285.05 g/mol. IUPAC name: 2-(3,4-difluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MLZHXAQBIJQKRN-UHFFFAOYSA-N.
| Molecular formula | C12H14BF2NO4 |
|---|---|
| Molecular weight | 285.05 g/mol |
| IUPAC name | 2-(3,4-difluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MLZHXAQBIJQKRN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)