cas: 2657617-91-7 — see every product listed under this CAS number, including other names
2-(3,4-Difluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95% (CAS 2657617-91-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13874R-100mg |
| cas | 2657617-91-7 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1686.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(3,4-difluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2657617-91-7) is a chemical compound with the molecular formula C12H14BF2NO4 and a molecular weight of 285.05 g/mol. IUPAC name: 2-(3,4-difluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MLZHXAQBIJQKRN-UHFFFAOYSA-N.
| Molecular formula | C12H14BF2NO4 |
|---|---|
| Molecular weight | 285.05 g/mol |
| IUPAC name | 2-(3,4-difluoro-5-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MLZHXAQBIJQKRN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)