2-(3,4-Dimethoxyphenyl)propanal, 95+%
cas: 40181-00-8 — see every product listed under this CAS number, including other names
2-(3,4-Dimethoxyphenyl)propanal, 95+% (CAS 40181-00-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A279348-100mg |
| cas | 40181-00-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 976.69 Pln | |
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1259.60 Pln | |
| BLDpharm | 100mg | 236.61 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 1047.43 Pln | |
| Fluorochem | 100mg | 695.61 Pln | |
| Fluorochem | 250mg | 992.38 Pln | |
| Fluorochem | 1g | 2335.65 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
2-(3,4-dimethoxyphenyl)propanal (CAS 40181-00-8) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)propanal. InChIKey: SGUITGYYSSRXRY-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)propanal |
| InChIKey | SGUITGYYSSRXRY-UHFFFAOYSA-N |
| SMILES | CC(C=O)C1=CC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)