cas: 408492-26-2 — see every product listed under this CAS number, including other names
2-(3,5-Dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 408492-26-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691680-5G |
| cas | 408492-26-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 825.77 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(3,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 408492-26-2) is a chemical compound with the molecular formula C12H15BBr2O2 and a molecular weight of 361.87 g/mol. IUPAC name: 2-(3,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WJYKUCWENIHKOC-UHFFFAOYSA-N.
| Molecular formula | C12H15BBr2O2 |
|---|---|
| Molecular weight | 361.87 g/mol |
| IUPAC name | 2-(3,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WJYKUCWENIHKOC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)