cas: 587-64-4 — see every product listed under this CAS number, including other names
2-(3,5-Dichlorophenoxy)acetic acid, 97%, 97% (CAS 587-64-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKUU-50mg |
| cas | 587-64-4 |
| size | 50mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 218.00 Pln | |
| Chemat | 100mg | 290.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(3,5-dichlorophenoxy)acetic acid (CAS 587-64-4) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2-(3,5-dichlorophenoxy)acetic acid. InChIKey: LXWGIMHMQOCPCR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(3,5-dichlorophenoxy)acetic acid |
| InChIKey | LXWGIMHMQOCPCR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)OCC(=O)O |
Computed by PubChem (NCBI)