CAS 587-64-4 appears in our catalog under these names: 2-(3,5-Dichlorophenoxy)acetic acid, 95%, 2-(3,5-Dichlorophenoxy)acetic acid, 95+%, 2-(3,5-Dichlorophenoxy)acetic acid, 2-(3,5-Dichlorophenoxy)acetic acid, 97%, 97%, 3,5-D. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, HPC Standards. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 0,5g, 50mg, 1x10mg.
2-(3,5-dichlorophenoxy)acetic acid (CAS 587-64-4) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2-(3,5-dichlorophenoxy)acetic acid. InChIKey: LXWGIMHMQOCPCR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(3,5-dichlorophenoxy)acetic acid |
| InChIKey | LXWGIMHMQOCPCR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)OCC(=O)O |
Computed by PubChem (NCBI)