2-(3,5-Difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane 98%
cas: 216393-57-6 — see every product listed under this CAS number, including other names
2-(3,5-Difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane 98% (CAS 216393-57-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A775473-250mg |
| cas | 216393-57-6 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 25g | 620.69 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A775473 |
2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 216393-57-6) is a chemical compound with the molecular formula C11H13BF2O2 and a molecular weight of 226.03 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: OLHRAEPCGZMMTI-UHFFFAOYSA-N.
| Molecular formula | C11H13BF2O2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | OLHRAEPCGZMMTI-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)
Synonyms:
2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 3,5-Difluorobenzeneboronic acid neopentyl glycol ester, 3,5-Difluorophenylboronic acid neopentyl glycol ester, 2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborane, 1,3,2-Dioxaborinane, 2-(3,5-difluorophenyl)-5,5-dimethyl-, 3,5-difluorobenzeneboronic acid neopentyl glycol, 3,5-Difluorophenylboronic acidneopentylglycol ester, 3,5-Difluorobenzenebornoic acid neopentyl glycol cyclic ester