cas: 1215867-50-7 — see every product listed under this CAS number, including other names
2-(3,6-dihydro-2,2-dimethyl-2H-pyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97% (CAS 1215867-50-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HGAN-100mg |
| cas | 1215867-50-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 674.00 Pln | |
| Chemat | 250mg | 1134.80 Pln | |
| Chemat | 1g | 2901.20 Pln | |
| Chemat | 5g | 10739.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(6,6-dimethyl-2,5-dihydropyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1215867-50-7) is a chemical compound with the molecular formula C13H23BO3 and a molecular weight of 238.13 g/mol. IUPAC name: 2-(6,6-dimethyl-2,5-dihydropyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CCGVKRLBJQCNMK-UHFFFAOYSA-N.
| Molecular formula | C13H23BO3 |
|---|---|
| Molecular weight | 238.13 g/mol |
| IUPAC name | 2-(6,6-dimethyl-2,5-dihydropyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CCGVKRLBJQCNMK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCOC(C2)(C)C |
Computed by PubChem (NCBI)